C7H15ClN2O4 — CID 10878881
[(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate (PubChem CID 10878881) has the molecular formula C7H15ClN2O4 and a molecular weight of 226.66 g/mol. Its IUPAC name is [(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate.
| Compound Name | [(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 10878881 |
| Molecular Formula | C7H15ClN2O4 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [(E)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate |
| SMILES | CN(C)/C=C/C=[N+](C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C7H15N2.ClHO4/c1-8(2)6-5-7-9(3)4;2-1(3,4)5/h5-7H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KPEJCTFEDXAYIE-UHFFFAOYSA-M |
| XLogP | -4.35 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|