C25H24N4O3 — CID 108788917
butyl 2-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]benzoate (PubChem CID 108788917) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is butyl 2-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]benzoate.
| Compound Name | butyl 2-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 108788917 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | butyl 2-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)c1cnn(-c2ccc3ccccc3n2)c1C |
| InChI | InChI=1S/C25H24N4O3/c1-3-4-15-32-25(31)19-10-6-8-12-22(19)28-24(30)20-16-26-29(17(20)2)23-14-13-18-9-5-7-11-21(18)27-23/h5-14,16H,3-4,15H2,1-2H3,(H,28,30) |
| InChIKey | NAZMLMMGQIVHAX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|