C12H14F3N — CID 10878939
(2R)-1-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]aziridine (PubChem CID 10878939) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is (2R)-1-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]aziridine.
| Compound Name | (2R)-1-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]aziridine |
|---|---|
| PubChem CID | 10878939 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (2R)-1-ethyl-2-[[3-(trifluoromethyl)phenyl]methyl]aziridine |
| SMILES | CCN1C[C@H]1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N/c1-2-16-8-11(16)7-9-4-3-5-10(6-9)12(13,14)15/h3-6,11H,2,7-8H2,1H3/t11-,16?/m1/s1 |
| InChIKey | OSOGRNRAJGAWFB-ZVDHGWRTSA-N |
| XLogP | 2.95 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|