C24H17F2N3O2 — CID 108790637
N-(2,6-difluorophenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide (PubChem CID 108790637) has the molecular formula C24H17F2N3O2 and a molecular weight of 417.42 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790637 |
| Molecular Formula | C24H17F2N3O2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
| SMILES | Cn1nc(-c2ccccc2)c(-c2ccccc2)c(C(=O)Nc2c(F)cccc2F)c1=O |
| InChI | InChI=1S/C24H17F2N3O2/c1-29-24(31)20(23(30)27-22-17(25)13-8-14-18(22)26)19(15-9-4-2-5-10-15)21(28-29)16-11-6-3-7-12-16/h2-14H,1H3,(H,27,30) |
| InChIKey | XZSNCRBFOGSQFK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |