C25H21N3O3 — CID 108790593
N-(4-hydroxy-2-methylphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide (PubChem CID 108790593) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790593 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
| SMILES | Cc1cc(O)ccc1NC(=O)c1c(-c2ccccc2)c(-c2ccccc2)nn(C)c1=O |
| InChI | InChI=1S/C25H21N3O3/c1-16-15-19(29)13-14-20(16)26-24(30)22-21(17-9-5-3-6-10-17)23(27-28(2)25(22)31)18-11-7-4-8-12-18/h3-15,29H,1-2H3,(H,26,30) |
| InChIKey | WKZXSBBDVWGOGO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|