C26H23N3O5S — CID 108790651
N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide (PubChem CID 108790651) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790651 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-methyl-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2c(-c3ccccc3)c(-c3ccccc3)nn(C)c2=O)c1 |
| InChI | InChI=1S/C26H23N3O5S/c1-3-35(33,34)19-14-15-21(30)20(16-19)27-25(31)23-22(17-10-6-4-7-11-17)24(28-29(2)26(23)32)18-12-8-5-9-13-18/h4-16,30H,3H2,1-2H3,(H,27,31) |
| InChIKey | KUMXVWWOMSKCIS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|