C22H23BrN4O3 — CID 108791542
1-(4-bromophenyl)-N-[4-(diethylamino)-2-methylphenyl]-4-hydroxy-6-oxopyridazine-3-carboxamide (PubChem CID 108791542) has the molecular formula C22H23BrN4O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[4-(diethylamino)-2-methylphenyl]-4-hydroxy-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[4-(diethylamino)-2-methylphenyl]-4-hydroxy-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108791542 |
| Molecular Formula | C22H23BrN4O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 1-(4-bromophenyl)-N-[4-(diethylamino)-2-methylphenyl]-4-hydroxy-6-oxopyridazine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2nn(-c3ccc(Br)cc3)c(=O)cc2O)c(C)c1 |
| InChI | InChI=1S/C22H23BrN4O3/c1-4-26(5-2)17-10-11-18(14(3)12-17)24-22(30)21-19(28)13-20(29)27(25-21)16-8-6-15(23)7-9-16/h6-13,28H,4-5H2,1-3H3,(H,24,30) |
| InChIKey | JPTQFIFKNDICTI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|