C18H13BrN4O5 — CID 108803884
1-(4-bromophenyl)-4-hydroxy-N-(2-methyl-5-nitrophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 108803884) has the molecular formula C18H13BrN4O5 and a molecular weight of 445.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-hydroxy-N-(2-methyl-5-nitrophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-4-hydroxy-N-(2-methyl-5-nitrophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108803884 |
| Molecular Formula | C18H13BrN4O5 |
| Molecular Weight | 445.23 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 1-(4-bromophenyl)-4-hydroxy-N-(2-methyl-5-nitrophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1nn(-c2ccc(Br)cc2)c(=O)cc1O |
| InChI | InChI=1S/C18H13BrN4O5/c1-10-2-5-13(23(27)28)8-14(10)20-18(26)17-15(24)9-16(25)22(21-17)12-6-3-11(19)4-7-12/h2-9,24H,1H3,(H,20,26) |
| InChIKey | FGNHXFDDZPWDHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|