C27H33N3O2 — CID 108792819
2-ethyl-N-(4-hexoxyphenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide (PubChem CID 108792819) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-ethyl-N-(4-hexoxyphenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide.
| Compound Name | 2-ethyl-N-(4-hexoxyphenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
|---|---|
| PubChem CID | 108792819 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-ethyl-N-(4-hexoxyphenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
| SMILES | CCCCCCOc1ccc(NC(=O)c2c3c(nc4ccccc24)CCN(CC)C3)cc1 |
| InChI | InChI=1S/C27H33N3O2/c1-3-5-6-9-18-32-21-14-12-20(13-15-21)28-27(31)26-22-10-7-8-11-24(22)29-25-16-17-30(4-2)19-23(25)26/h7-8,10-15H,3-6,9,16-19H2,1-2H3,(H,28,31) |
| InChIKey | OQPNTOKELDCQGN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|