methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate

C15H27NO2 — CID 10879623

IUPACmethyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate
SMILESCCCCCCCCC[C@@H]1CC=CN1C(=O)OC
InChIInChI=1S/C15H27NO2/c1-3-4-5-6-7-8-9-11-14-12-10-13-16(14)15(17)18-2/h10,13-14H,3-9,11-12H2,1-2H3/t14-/m1/s1
InChIKeyLMVDPQZZRDXCIW-CQSZACIVSA-N
MW253.39 g/mol
LogP4.48
Rot. Bonds8

About methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate

methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 10879623) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate.

Molecular Properties

Compound Namemethyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate
PubChem CID10879623
Molecular FormulaC15H27NO2
Molecular Weight253.39 g/mol
Exact Mass253.20
IUPAC Namemethyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate
SMILESCCCCCCCCC[C@@H]1CC=CN1C(=O)OC
InChIInChI=1S/C15H27NO2/c1-3-4-5-6-7-8-9-11-14-12-10-13-16(14)15(17)18-2/h10,13-14H,3-9,11-12H2,1-2H3/t14-/m1/s1
InChIKeyLMVDPQZZRDXCIW-CQSZACIVSA-N
XLogP4.48
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.39
LogP ≤ 54.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate?
The IUPAC name of methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate (CID 10879623) is methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate.
What is the SMILES notation for methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate?
The canonical SMILES for methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate is CCCCCCCCC[C@@H]1CC=CN1C(=O)OC.
What is the InChIKey of methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate?
The InChIKey is LMVDPQZZRDXCIW-CQSZACIVSA-N. The full InChI is InChI=1S/C15H27NO2/c1-3-4-5-6-7-8-9-11-14-12-10-13-16(14)15(17)18-2/h10,13-14H,3-9,11-12H2,1-2H3/t14-/m1/s1.
What are the key properties of methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate?
methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate has a molecular weight of 253.39 g/mol, XLogP of 4.48, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 10879623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).