C15H27NO2 — CID 10879623
methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 10879623) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10879623 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | methyl (2R)-2-nonyl-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1CC=CN1C(=O)OC |
| InChI | InChI=1S/C15H27NO2/c1-3-4-5-6-7-8-9-11-14-12-10-13-16(14)15(17)18-2/h10,13-14H,3-9,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | LMVDPQZZRDXCIW-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|