methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate

C13H21NO2 — CID 11160406

IUPACmethyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate
SMILESC=CC[C@@H]1CCC[C@@H](CC=C)N1C(=O)OC
InChIInChI=1S/C13H21NO2/c1-4-7-11-9-6-10-12(8-5-2)14(11)13(15)16-3/h4-5,11-12H,1-2,6-10H2,3H3/t11-,12-/m1/s1
InChIKeyRPIIQAAVNAGYKK-VXGBXAGGSA-N
MW223.32 g/mol
LogP3.13
Rot. Bonds4

About methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate

methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate (PubChem CID 11160406) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate.

Molecular Properties

Compound Namemethyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate
PubChem CID11160406
Molecular FormulaC13H21NO2
Molecular Weight223.32 g/mol
Exact Mass223.16
IUPAC Namemethyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate
SMILESC=CC[C@@H]1CCC[C@@H](CC=C)N1C(=O)OC
InChIInChI=1S/C13H21NO2/c1-4-7-11-9-6-10-12(8-5-2)14(11)13(15)16-3/h4-5,11-12H,1-2,6-10H2,3H3/t11-,12-/m1/s1
InChIKeyRPIIQAAVNAGYKK-VXGBXAGGSA-N
XLogP3.13
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.32
LogP ≤ 53.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate?
The IUPAC name of methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate (CID 11160406) is methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate.
What is the SMILES notation for methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate?
The canonical SMILES for methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate is C=CC[C@@H]1CCC[C@@H](CC=C)N1C(=O)OC.
What is the InChIKey of methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate?
The InChIKey is RPIIQAAVNAGYKK-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H21NO2/c1-4-7-11-9-6-10-12(8-5-2)14(11)13(15)16-3/h4-5,11-12H,1-2,6-10H2,3H3/t11-,12-/m1/s1.
What are the key properties of methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate?
methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate has a molecular weight of 223.32 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,6S)-2,6-bis(prop-2-enyl)piperidine-1-carboxylate is sourced from PubChem (CID 11160406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).