C12H14O4S — CID 10879647
[(1S,2S,6S)-11,11-dioxo-11λ6-thiabicyclo[4.4.1]undeca-3,7,9-trien-2-yl] acetate (PubChem CID 10879647) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is [(1S,2S,6S)-11,11-dioxo-11λ6-thiabicyclo[4.4.1]undeca-3,7,9-trien-2-yl] acetate.
| Compound Name | [(1S,2S,6S)-11,11-dioxo-11λ6-thiabicyclo[4.4.1]undeca-3,7,9-trien-2-yl] acetate |
|---|---|
| PubChem CID | 10879647 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [(1S,2S,6S)-11,11-dioxo-11λ6-thiabicyclo[4.4.1]undeca-3,7,9-trien-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC[C@H]2C=CC=C[C@@H]1S2(=O)=O |
| InChI | InChI=1S/C12H14O4S/c1-9(13)16-11-7-4-6-10-5-2-3-8-12(11)17(10,14)15/h2-5,7-8,10-12H,6H2,1H3/t10-,11+,12+/m1/s1 |
| InChIKey | GHEQNELZNAQRJJ-WOPDTQHZSA-N |
| XLogP | 1.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|