C10H12O4S — CID 148823093
7-methyl-4,4-dioxo-7,9a-dihydro-4aH-cyclohepta[b][1,4]oxathiin-2-one (PubChem CID 148823093) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 7-methyl-4,4-dioxo-7,9a-dihydro-4aH-cyclohepta[b][1,4]oxathiin-2-one.
| Compound Name | 7-methyl-4,4-dioxo-7,9a-dihydro-4aH-cyclohepta[b][1,4]oxathiin-2-one |
|---|---|
| PubChem CID | 148823093 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 7-methyl-4,4-dioxo-7,9a-dihydro-4aH-cyclohepta[b][1,4]oxathiin-2-one |
| SMILES | CC1C=CC2OC(=O)CS(=O)(=O)C2C=C1 |
| InChI | InChI=1S/C10H12O4S/c1-7-2-4-8-9(5-3-7)15(12,13)6-10(11)14-8/h2-5,7-9H,6H2,1H3 |
| InChIKey | OSEDPFXREXCAIT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|