C14H22O7S — CID 122389495
[(2R,3S,6R)-3-acetyloxy-6-butylsulfonyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 122389495) has the molecular formula C14H22O7S and a molecular weight of 334.39 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-butylsulfonyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-butylsulfonyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122389495 |
| Molecular Formula | C14H22O7S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-butylsulfonyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCCCS(=O)(=O)[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C14H22O7S/c1-4-5-8-22(17,18)14-7-6-12(20-11(3)16)13(21-14)9-19-10(2)15/h6-7,12-14H,4-5,8-9H2,1-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | BEAOBIKXTWFMHD-BFHYXJOUSA-N |
| XLogP | 0.98 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|