C12H22O4S — CID 176637587
(5E)-4-ethoxy-3-methoxy-8-methylsulfonylocta-1,5-diene (PubChem CID 176637587) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is (5E)-4-ethoxy-3-methoxy-8-methylsulfonylocta-1,5-diene.
| Compound Name | (5E)-4-ethoxy-3-methoxy-8-methylsulfonylocta-1,5-diene |
|---|---|
| PubChem CID | 176637587 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (5E)-4-ethoxy-3-methoxy-8-methylsulfonylocta-1,5-diene |
| SMILES | C=CC(OC)C(/C=C/CCS(C)(=O)=O)OCC |
| InChI | InChI=1S/C12H22O4S/c1-5-11(15-3)12(16-6-2)9-7-8-10-17(4,13)14/h5,7,9,11-12H,1,6,8,10H2,2-4H3/b9-7+ |
| InChIKey | YKDAUPLEBXNWKJ-VQHVLOKHSA-N |
| XLogP | 1.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|