C10H18O5S — CID 165489685
3-[2-(3-methoxypropoxy)ethoxy]-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 165489685) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-[2-(3-methoxypropoxy)ethoxy]-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-[2-(3-methoxypropoxy)ethoxy]-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 165489685 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-[2-(3-methoxypropoxy)ethoxy]-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | COCCCOCCOC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18O5S/c1-13-4-2-5-14-6-7-15-10-3-8-16(11,12)9-10/h3,8,10H,2,4-7,9H2,1H3 |
| InChIKey | BLIQFNCBXVKUIP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|