C10H16O4S — CID 7038885
(3R,4S)-3,4-bis(prop-2-enoxy)thiolane 1,1-dioxide (PubChem CID 7038885) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is (3R,4S)-3,4-bis(prop-2-enoxy)thiolane 1,1-dioxide.
| Compound Name | (3R,4S)-3,4-bis(prop-2-enoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7038885 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (3R,4S)-3,4-bis(prop-2-enoxy)thiolane 1,1-dioxide |
| SMILES | C=CCO[C@H]1CS(=O)(=O)C[C@H]1OCC=C |
| InChI | InChI=1S/C10H16O4S/c1-3-5-13-9-7-15(11,12)8-10(9)14-6-4-2/h3-4,9-10H,1-2,5-8H2/t9-,10+ |
| InChIKey | KDHWGEZUFBKRRL-AOOOYVTPSA-N |
| XLogP | 0.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|