C11H16O2 — CID 85352831
3,5-bis(prop-2-enoxy)cyclopentene (PubChem CID 85352831) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,5-bis(prop-2-enoxy)cyclopentene.
| Compound Name | 3,5-bis(prop-2-enoxy)cyclopentene |
|---|---|
| PubChem CID | 85352831 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3,5-bis(prop-2-enoxy)cyclopentene |
| SMILES | C=CCOC1C=CC(OCC=C)C1 |
| InChI | InChI=1S/C11H16O2/c1-3-7-12-10-5-6-11(9-10)13-8-4-2/h3-6,10-11H,1-2,7-9H2 |
| InChIKey | RKEVPEMDBHLGHV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|