C10H14O3 — CID 22215343
(2R,5S)-2,5-bis(prop-2-enoxy)-2,5-dihydrofuran (PubChem CID 22215343) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R,5S)-2,5-bis(prop-2-enoxy)-2,5-dihydrofuran.
| Compound Name | (2R,5S)-2,5-bis(prop-2-enoxy)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 22215343 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2R,5S)-2,5-bis(prop-2-enoxy)-2,5-dihydrofuran |
| SMILES | C=CCO[C@H]1C=C[C@@H](OCC=C)O1 |
| InChI | InChI=1S/C10H14O3/c1-3-7-11-9-5-6-10(13-9)12-8-4-2/h3-6,9-10H,1-2,7-8H2/t9-,10+ |
| InChIKey | QLVULHSNUMTCSZ-AOOOYVTPSA-N |
| XLogP | 1.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|