C13H22O4S — CID 123193050
5-(2-methoxyethoxy)-6-methylsulfonyl-2-propan-2-ylcyclohexa-1,3-diene (PubChem CID 123193050) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is 5-(2-methoxyethoxy)-6-methylsulfonyl-2-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | 5-(2-methoxyethoxy)-6-methylsulfonyl-2-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123193050 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-(2-methoxyethoxy)-6-methylsulfonyl-2-propan-2-ylcyclohexa-1,3-diene |
| SMILES | COCCOC1C=CC(C(C)C)=CC1S(C)(=O)=O |
| InChI | InChI=1S/C13H22O4S/c1-10(2)11-5-6-12(17-8-7-16-3)13(9-11)18(4,14)15/h5-6,9-10,12-13H,7-8H2,1-4H3 |
| InChIKey | YROOLXCEAQFEHM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|