C12H20O3S — CID 165001616
(5S,6S)-5,6-dimethyl-2-(3-methylsulfonylpropoxy)cyclohexa-1,3-diene (PubChem CID 165001616) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethyl-2-(3-methylsulfonylpropoxy)cyclohexa-1,3-diene.
| Compound Name | (5S,6S)-5,6-dimethyl-2-(3-methylsulfonylpropoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 165001616 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (5S,6S)-5,6-dimethyl-2-(3-methylsulfonylpropoxy)cyclohexa-1,3-diene |
| SMILES | C[C@@H]1C=C(OCCCS(C)(=O)=O)C=C[C@@H]1C |
| InChI | InChI=1S/C12H20O3S/c1-10-5-6-12(9-11(10)2)15-7-4-8-16(3,13)14/h5-6,9-11H,4,7-8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | RNOXNGWYEPZZAG-WDEREUQCSA-N |
| XLogP | 2.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|