C11H18O3S — CID 143711864
2-butoxy-5-methylsulfonylcyclohexa-1,3-diene (PubChem CID 143711864) has the molecular formula C11H18O3S and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-butoxy-5-methylsulfonylcyclohexa-1,3-diene.
| Compound Name | 2-butoxy-5-methylsulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143711864 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-butoxy-5-methylsulfonylcyclohexa-1,3-diene |
| SMILES | CCCCOC1=CCC(S(C)(=O)=O)C=C1 |
| InChI | InChI=1S/C11H18O3S/c1-3-4-9-14-10-5-7-11(8-6-10)15(2,12)13/h5-7,11H,3-4,8-9H2,1-2H3 |
| InChIKey | BXTBMGVGVZEBCB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|