C8H10F2O3S — CID 162543156
2-(difluoromethoxy)-5-methylsulfonylcyclohexa-1,3-diene (PubChem CID 162543156) has the molecular formula C8H10F2O3S and a molecular weight of 224.23 g/mol. Its IUPAC name is 2-(difluoromethoxy)-5-methylsulfonylcyclohexa-1,3-diene.
| Compound Name | 2-(difluoromethoxy)-5-methylsulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 162543156 |
| Molecular Formula | C8H10F2O3S |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-(difluoromethoxy)-5-methylsulfonylcyclohexa-1,3-diene |
| SMILES | CS(=O)(=O)C1C=CC(OC(F)F)=CC1 |
| InChI | InChI=1S/C8H10F2O3S/c1-14(11,12)7-4-2-6(3-5-7)13-8(9)10/h2-4,7-8H,5H2,1H3 |
| InChIKey | IPDSERXLRTVQCR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |