C12H22O2S — CID 101439978
(2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyl-3,6-dihydro-2H-pyran (PubChem CID 101439978) has the molecular formula C12H22O2S and a molecular weight of 230.37 g/mol. Its IUPAC name is (2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 101439978 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyl-3,6-dihydro-2H-pyran |
| SMILES | C[C@@H]1C=C[C@@H](C)[C@H](CS(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H22O2S/c1-9-6-7-10(2)14-11(9)8-15(13)12(3,4)5/h6-7,9-11H,8H2,1-5H3/t9-,10-,11+,15?/m1/s1 |
| InChIKey | SEVQREDDZXMKRC-LCONVBBXSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|