C10H14O3S — CID 147711106
7-methyl-3,4a,7,9a-tetrahydro-2H-cyclohepta[b][1,4]oxathiine 4,4-dioxide (PubChem CID 147711106) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 7-methyl-3,4a,7,9a-tetrahydro-2H-cyclohepta[b][1,4]oxathiine 4,4-dioxide.
| Compound Name | 7-methyl-3,4a,7,9a-tetrahydro-2H-cyclohepta[b][1,4]oxathiine 4,4-dioxide |
|---|---|
| PubChem CID | 147711106 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 7-methyl-3,4a,7,9a-tetrahydro-2H-cyclohepta[b][1,4]oxathiine 4,4-dioxide |
| SMILES | CC1C=CC2OCCS(=O)(=O)C2C=C1 |
| InChI | InChI=1S/C10H14O3S/c1-8-2-4-9-10(5-3-8)14(11,12)7-6-13-9/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | GUSLXIAUVZSJEC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|