C12H12O3S — CID 139805333
4a,5a,9a,10a-tetrahydrophenoxathiine 10,10-dioxide (PubChem CID 139805333) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is 4a,5a,9a,10a-tetrahydrophenoxathiine 10,10-dioxide.
| Compound Name | 4a,5a,9a,10a-tetrahydrophenoxathiine 10,10-dioxide |
|---|---|
| PubChem CID | 139805333 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 4a,5a,9a,10a-tetrahydrophenoxathiine 10,10-dioxide |
| SMILES | O=S1(=O)C2C=CC=CC2OC2C=CC=CC21 |
| InChI | InChI=1S/C12H12O3S/c13-16(14)11-7-3-1-5-9(11)15-10-6-2-4-8-12(10)16/h1-12H |
| InChIKey | ZJRJDWALKLNIEH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |