C12H20O3S — CID 102217976
3-methyl-5-methylsulfonyl-6-[(E)-pent-1-enyl]-3,6-dihydro-2H-pyran (PubChem CID 102217976) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-methyl-5-methylsulfonyl-6-[(E)-pent-1-enyl]-3,6-dihydro-2H-pyran.
| Compound Name | 3-methyl-5-methylsulfonyl-6-[(E)-pent-1-enyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102217976 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-methyl-5-methylsulfonyl-6-[(E)-pent-1-enyl]-3,6-dihydro-2H-pyran |
| SMILES | CCC/C=C/C1OCC(C)C=C1S(C)(=O)=O |
| InChI | InChI=1S/C12H20O3S/c1-4-5-6-7-11-12(16(3,13)14)8-10(2)9-15-11/h6-8,10-11H,4-5,9H2,1-3H3/b7-6+ |
| InChIKey | IDKIGNQUTMTYGE-VOTSOKGWSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|