C14H24O2S — CID 11436785
3-[(1R)-2-tert-butylsulfinyl-1-methoxyethyl]-3-methylcyclohexa-1,4-diene (PubChem CID 11436785) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is 3-[(1R)-2-tert-butylsulfinyl-1-methoxyethyl]-3-methylcyclohexa-1,4-diene.
| Compound Name | 3-[(1R)-2-tert-butylsulfinyl-1-methoxyethyl]-3-methylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 11436785 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-[(1R)-2-tert-butylsulfinyl-1-methoxyethyl]-3-methylcyclohexa-1,4-diene |
| SMILES | CO[C@@H](CS(=O)C(C)(C)C)C1(C)C=CCC=C1 |
| InChI | InChI=1S/C14H24O2S/c1-13(2,3)17(15)11-12(16-5)14(4)9-7-6-8-10-14/h7-10,12H,6,11H2,1-5H3/t12-,17?/m0/s1 |
| InChIKey | JFWXJFZKUKZSIZ-WHUIICBVSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|