About [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate
[(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate (PubChem CID 11243097) has the molecular formula C15H24O3S
and a molecular weight of 284.42 g/mol. Its IUPAC name is [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate.
Molecular Properties
| Compound Name | [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate |
| PubChem CID | 11243097 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate |
| SMILES | CC(=O)O[C@@H](CS(=O)C(C)(C)C)C1(C)C=CCC=C1 |
| InChI | InChI=1S/C15H24O3S/c1-12(16)18-13(11-19(17)14(2,3)4)15(5)9-7-6-8-10-15/h7-10,13H,6,11H2,1-5H3/t13-,19?/m0/s1 |
| InChIKey | YZLNNIGPUSTBKU-YTJLLHSVSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate?
The IUPAC name of [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate (CID 11243097) is [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate.
What is the SMILES notation for [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate?
The canonical SMILES for [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate is CC(=O)O[C@@H](CS(=O)C(C)(C)C)C1(C)C=CCC=C1.
What is the InChIKey of [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate?
The InChIKey is YZLNNIGPUSTBKU-YTJLLHSVSA-N. The full InChI is InChI=1S/C15H24O3S/c1-12(16)18-13(11-19(17)14(2,3)4)15(5)9-7-6-8-10-15/h7-10,13H,6,11H2,1-5H3/t13-,19?/m0/s1.
What are the key properties of [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate?
[(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate has a molecular weight of 284.42 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethyl] acetate is sourced from PubChem (CID 11243097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).