C12H18O2S — CID 11253136
(2R,4R,5S)-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide (PubChem CID 11253136) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is (2R,4R,5S)-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide.
| Compound Name | (2R,4R,5S)-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide |
|---|---|
| PubChem CID | 11253136 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2R,4R,5S)-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide |
| SMILES | C[C@H]1CO[C@H](C2(C)C=CCC=C2)C[S@]1=O |
| InChI | InChI=1S/C12H18O2S/c1-10-8-14-11(9-15(10)13)12(2)6-4-3-5-7-12/h4-7,10-11H,3,8-9H2,1-2H3/t10-,11-,15+/m0/s1 |
| InChIKey | WPVPMQPHNSSKOJ-ZIBATOQPSA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|