C12H21NO2S — CID 11334012
(2R,5S)-4-hydroxy-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathian-4-amine (PubChem CID 11334012) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is (2R,5S)-4-hydroxy-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathian-4-amine.
| Compound Name | (2R,5S)-4-hydroxy-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathian-4-amine |
|---|---|
| PubChem CID | 11334012 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2R,5S)-4-hydroxy-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathian-4-amine |
| SMILES | C[C@H]1CO[C@H](C2(C)C=CCC=C2)CS1(N)O |
| InChI | InChI=1S/C12H21NO2S/c1-10-8-15-11(9-16(10,13)14)12(2)6-4-3-5-7-12/h4-7,10-11,14H,3,8-9,13H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | CFYMQZPHCWOGLC-QWRGUYRKSA-N |
| XLogP | 2.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|