C12H19NO2S — CID 139189918
(2S,4S,5R)-4-imino-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide (PubChem CID 139189918) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is (2S,4S,5R)-4-imino-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide.
| Compound Name | (2S,4S,5R)-4-imino-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide |
|---|---|
| PubChem CID | 139189918 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2S,4S,5R)-4-imino-5-methyl-2-(1-methylcyclohexa-2,5-dien-1-yl)-1,4-oxathiane 4-oxide |
| SMILES | [H]N=[S@]1(=O)C[C@H](C2(C)C=CCC=C2)OC[C@H]1C |
| InChI | InChI=1S/C12H19NO2S/c1-10-8-15-11(9-16(10,13)14)12(2)6-4-3-5-7-12/h4-7,10-11,13H,3,8-9H2,1-2H3/t10-,11-,16+/m1/s1 |
| InChIKey | JBRLYEDLTWTVFL-UVWXRNBGSA-N |
| XLogP | 2.34 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|