C13H22O2S — CID 11195882
(1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethanol (PubChem CID 11195882) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is (1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethanol.
| Compound Name | (1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 11195882 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1R)-2-tert-butylsulfinyl-1-(1-methylcyclohexa-2,5-dien-1-yl)ethanol |
| SMILES | CC1([C@@H](O)CS(=O)C(C)(C)C)C=CCC=C1 |
| InChI | InChI=1S/C13H22O2S/c1-12(2,3)16(15)10-11(14)13(4)8-6-5-7-9-13/h6-9,11,14H,5,10H2,1-4H3/t11-,16?/m0/s1 |
| InChIKey | CXBQYELJNKVILO-CHPOKUKFSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|