C12H20O2S — CID 134896590
(1R)-2-tert-butylsulfinyl-1-cyclohexa-2,5-dien-1-ylethanol (PubChem CID 134896590) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is (1R)-2-tert-butylsulfinyl-1-cyclohexa-2,5-dien-1-ylethanol.
| Compound Name | (1R)-2-tert-butylsulfinyl-1-cyclohexa-2,5-dien-1-ylethanol |
|---|---|
| PubChem CID | 134896590 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1R)-2-tert-butylsulfinyl-1-cyclohexa-2,5-dien-1-ylethanol |
| SMILES | CC(C)(C)S(=O)C[C@H](O)C1C=CCC=C1 |
| InChI | InChI=1S/C12H20O2S/c1-12(2,3)15(14)9-11(13)10-7-5-4-6-8-10/h5-8,10-11,13H,4,9H2,1-3H3/t11-,15?/m0/s1 |
| InChIKey | RZYYZKIIQOCDND-VPHXOMNUSA-N |
| XLogP | 2.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|