C10H18O2S2 — CID 14737997
(1R)-1-[(2S)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]propan-1-ol (PubChem CID 14737997) has the molecular formula C10H18O2S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (1R)-1-[(2S)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]propan-1-ol.
| Compound Name | (1R)-1-[(2S)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 14737997 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (1R)-1-[(2S)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]propan-1-ol |
| SMILES | C/C=C/[C@]1([C@H](O)CC)SCCCS1=O |
| InChI | InChI=1S/C10H18O2S2/c1-3-6-10(9(11)4-2)13-7-5-8-14(10)12/h3,6,9,11H,4-5,7-8H2,1-2H3/b6-3+/t9-,10+,14?/m1/s1 |
| InChIKey | VRZSVOQLUBKYBP-BOKBDREISA-N |
| XLogP | 1.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|