C14H28OS2 — CID 15162955
(Z,2R)-1,1-bis(ethylsulfanyl)dec-4-en-2-ol (PubChem CID 15162955) has the molecular formula C14H28OS2 and a molecular weight of 276.51 g/mol. Its IUPAC name is (Z,2R)-1,1-bis(ethylsulfanyl)dec-4-en-2-ol.
| Compound Name | (Z,2R)-1,1-bis(ethylsulfanyl)dec-4-en-2-ol |
|---|---|
| PubChem CID | 15162955 |
| Molecular Formula | C14H28OS2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (Z,2R)-1,1-bis(ethylsulfanyl)dec-4-en-2-ol |
| SMILES | CCCCC/C=C\C[C@@H](O)C(SCC)SCC |
| InChI | InChI=1S/C14H28OS2/c1-4-7-8-9-10-11-12-13(15)14(16-5-2)17-6-3/h10-11,13-15H,4-9,12H2,1-3H3/b11-10-/t13-/m1/s1 |
| InChIKey | XREHZIXWKOSZHG-BSYHEUMXSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|