C10H18OS2 — CID 101394705
(E)-1-(1,3-dithian-2-yl)hex-4-en-2-ol (PubChem CID 101394705) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is (E)-1-(1,3-dithian-2-yl)hex-4-en-2-ol.
| Compound Name | (E)-1-(1,3-dithian-2-yl)hex-4-en-2-ol |
|---|---|
| PubChem CID | 101394705 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (E)-1-(1,3-dithian-2-yl)hex-4-en-2-ol |
| SMILES | C/C=C/CC(O)CC1SCCCS1 |
| InChI | InChI=1S/C10H18OS2/c1-2-3-5-9(11)8-10-12-6-4-7-13-10/h2-3,9-11H,4-8H2,1H3/b3-2+ |
| InChIKey | LOQPTIKCXTVCEE-NSCUHMNNSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|