C23H46OS2Sn — CID 134905822
(E,2S,3S)-1-(1,3-dithian-2-yl)-3-methyl-5-tributylstannylhex-4-en-2-ol (PubChem CID 134905822) has the molecular formula C23H46OS2Sn and a molecular weight of 521.47 g/mol. Its IUPAC name is (E,2S,3S)-1-(1,3-dithian-2-yl)-3-methyl-5-tributylstannylhex-4-en-2-ol.
| Compound Name | (E,2S,3S)-1-(1,3-dithian-2-yl)-3-methyl-5-tributylstannylhex-4-en-2-ol |
|---|---|
| PubChem CID | 134905822 |
| Molecular Formula | C23H46OS2Sn |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (E,2S,3S)-1-(1,3-dithian-2-yl)-3-methyl-5-tributylstannylhex-4-en-2-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C/[C@H](C)[C@@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C11H19OS2.3C4H9.Sn/c1-3-5-9(2)10(12)8-11-13-6-4-7-14-11;3*1-3-4-2;/h5,9-12H,4,6-8H2,1-2H3;3*1,3-4H2,2H3;/t9-,10-;;;;/m0..../s1 |
| InChIKey | LCWJMJDVQAMGFU-IJBXMQGASA-N |
| XLogP | 7.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |