C10H18OS2 — CID 10104815
(2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylpentan-3-ol (PubChem CID 10104815) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylpentan-3-ol.
| Compound Name | (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 10104815 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methylpentan-3-ol |
| SMILES | CC[C@@H](O)[C@@H](C)C=C1SCCCS1 |
| InChI | InChI=1S/C10H18OS2/c1-3-9(11)8(2)7-10-12-5-4-6-13-10/h7-9,11H,3-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | IHGNLDJEGQWIOK-DTWKUNHWSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |