C14H24OS2 — CID 11086915
(3R,4R)-1-(1,3-dithian-2-ylidene)-3,7-dimethyloct-6-en-4-ol (PubChem CID 11086915) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is (3R,4R)-1-(1,3-dithian-2-ylidene)-3,7-dimethyloct-6-en-4-ol.
| Compound Name | (3R,4R)-1-(1,3-dithian-2-ylidene)-3,7-dimethyloct-6-en-4-ol |
|---|---|
| PubChem CID | 11086915 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3R,4R)-1-(1,3-dithian-2-ylidene)-3,7-dimethyloct-6-en-4-ol |
| SMILES | CC(C)=CC[C@@H](O)[C@H](C)CC=C1SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-11(2)5-7-13(15)12(3)6-8-14-16-9-4-10-17-14/h5,8,12-13,15H,4,6-7,9-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | IVHOYIXOUHZATA-CHWSQXEVSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|