C12H24OS — CID 91464734
1-(3-methylcyclohex-3-en-1-yl)-2-(trimethyl-λ4-sulfanyl)ethanol (PubChem CID 91464734) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is 1-(3-methylcyclohex-3-en-1-yl)-2-(trimethyl-λ4-sulfanyl)ethanol.
| Compound Name | 1-(3-methylcyclohex-3-en-1-yl)-2-(trimethyl-λ4-sulfanyl)ethanol |
|---|---|
| PubChem CID | 91464734 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(3-methylcyclohex-3-en-1-yl)-2-(trimethyl-λ4-sulfanyl)ethanol |
| SMILES | CC1=CCCC(C(O)CS(C)(C)C)C1 |
| InChI | InChI=1S/C12H24OS/c1-10-6-5-7-11(8-10)12(13)9-14(2,3)4/h6,11-13H,5,7-9H2,1-4H3 |
| InChIKey | GTEKANMZOIHCSA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|