C15H21F3OS — CID 143813996
ethene;4-methyl-2-[(3S,5E)-7,7,7-trifluoro-6-methylhepta-1,5-dien-3-yl]-2,3-dihydrothiophen-3-ol (PubChem CID 143813996) has the molecular formula C15H21F3OS and a molecular weight of 306.39 g/mol. Its IUPAC name is ethene;4-methyl-2-[(3S,5E)-7,7,7-trifluoro-6-methylhepta-1,5-dien-3-yl]-2,3-dihydrothiophen-3-ol.
| Compound Name | ethene;4-methyl-2-[(3S,5E)-7,7,7-trifluoro-6-methylhepta-1,5-dien-3-yl]-2,3-dihydrothiophen-3-ol |
|---|---|
| PubChem CID | 143813996 |
| Molecular Formula | C15H21F3OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethene;4-methyl-2-[(3S,5E)-7,7,7-trifluoro-6-methylhepta-1,5-dien-3-yl]-2,3-dihydrothiophen-3-ol |
| SMILES | C=C.C=C[C@H](C/C=C(\C)C(F)(F)F)C1SC=C(C)C1O |
| InChI | InChI=1S/C13H17F3OS.C2H4/c1-4-10(6-5-9(3)13(14,15)16)12-11(17)8(2)7-18-12;1-2/h4-5,7,10-12,17H,1,6H2,2-3H3;1-2H2/b9-5+;/t10-,11?,12?;/m1./s1 |
| InChIKey | IDMBUCBQTQQSEI-DRSCKCSZSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|