C11H17F3OS — CID 116627292
5,5-dimethyl-3-[2-(trifluoromethylsulfanyl)ethyl]cyclohex-2-en-1-ol (PubChem CID 116627292) has the molecular formula C11H17F3OS and a molecular weight of 254.32 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-(trifluoromethylsulfanyl)ethyl]cyclohex-2-en-1-ol.
| Compound Name | 5,5-dimethyl-3-[2-(trifluoromethylsulfanyl)ethyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 116627292 |
| Molecular Formula | C11H17F3OS |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5,5-dimethyl-3-[2-(trifluoromethylsulfanyl)ethyl]cyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(CCSC(F)(F)F)=CC(O)C1 |
| InChI | InChI=1S/C11H17F3OS/c1-10(2)6-8(5-9(15)7-10)3-4-16-11(12,13)14/h5,9,15H,3-4,6-7H2,1-2H3 |
| InChIKey | BVACRYTZZJAAHN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|