C14H26OS — CID 123301958
5,5-dimethyl-3-[(1-methylthiolan-1-yl)methyl]cyclohex-2-en-1-ol (PubChem CID 123301958) has the molecular formula C14H26OS and a molecular weight of 242.43 g/mol. Its IUPAC name is 5,5-dimethyl-3-[(1-methylthiolan-1-yl)methyl]cyclohex-2-en-1-ol.
| Compound Name | 5,5-dimethyl-3-[(1-methylthiolan-1-yl)methyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 123301958 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 5,5-dimethyl-3-[(1-methylthiolan-1-yl)methyl]cyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(CS2(C)CCCC2)=CC(O)C1 |
| InChI | InChI=1S/C14H26OS/c1-14(2)9-12(8-13(15)10-14)11-16(3)6-4-5-7-16/h8,13,15H,4-7,9-11H2,1-3H3 |
| InChIKey | KUSWUQNLYOPXPT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|