C46H90OS4 — CID 19598157
2-tert-butyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol (PubChem CID 19598157) has the molecular formula C46H90OS4 and a molecular weight of 787.49 g/mol. Its IUPAC name is 2-tert-butyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol.
| Compound Name | 2-tert-butyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 19598157 |
| Molecular Formula | C46H90OS4 |
| Molecular Weight | 787.49 g/mol |
| Exact Mass | 786.59 |
| IUPAC Name | 2-tert-butyl-4,4,6,6-tetrakis(octylsulfanylmethyl)cyclohex-2-en-1-ol |
| SMILES | CCCCCCCCSCC1(CSCCCCCCCC)C=C(C(C)(C)C)C(O)C(CSCCCCCCCC)(CSCCCCCCCC)C1 |
| InChI | InChI=1S/C46H90OS4/c1-8-12-16-20-24-28-32-48-38-45(39-49-33-29-25-21-17-13-9-2)36-42(44(5,6)7)43(47)46(37-45,40-50-34-30-26-22-18-14-10-3)41-51-35-31-27-23-19-15-11-4/h36,43,47H,8-35,37-41H2,1-7H3 |
| InChIKey | FKLJBSYFCHRXEU-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.49 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|