C13H23OS+ — CID 58718092
5,5-dimethyl-3-(thiolan-1-ium-1-ylmethyl)cyclohex-2-en-1-ol (PubChem CID 58718092) has the molecular formula C13H23OS+ and a molecular weight of 227.39 g/mol. Its IUPAC name is 5,5-dimethyl-3-(thiolan-1-ium-1-ylmethyl)cyclohex-2-en-1-ol.
| Compound Name | 5,5-dimethyl-3-(thiolan-1-ium-1-ylmethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 58718092 |
| Molecular Formula | C13H23OS+ |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5,5-dimethyl-3-(thiolan-1-ium-1-ylmethyl)cyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(C[S+]2CCCC2)=CC(O)C1 |
| InChI | InChI=1S/C13H23OS/c1-13(2)8-11(7-12(14)9-13)10-15-5-3-4-6-15/h7,12,14H,3-6,8-10H2,1-2H3/q+1 |
| InChIKey | JHCFALQDVSEURP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|