C20H33F3O2S — CID 57170794
(1R,2S)-3-hexylsulfanyl-2-[(3S)-3-hydroxyoct-1-enyl]-4-(trifluoromethyl)cyclopent-3-en-1-ol (PubChem CID 57170794) has the molecular formula C20H33F3O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is (1R,2S)-3-hexylsulfanyl-2-[(3S)-3-hydroxyoct-1-enyl]-4-(trifluoromethyl)cyclopent-3-en-1-ol.
| Compound Name | (1R,2S)-3-hexylsulfanyl-2-[(3S)-3-hydroxyoct-1-enyl]-4-(trifluoromethyl)cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 57170794 |
| Molecular Formula | C20H33F3O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | (1R,2S)-3-hexylsulfanyl-2-[(3S)-3-hydroxyoct-1-enyl]-4-(trifluoromethyl)cyclopent-3-en-1-ol |
| SMILES | CCCCCCSC1=C(C(F)(F)F)C[C@@H](O)[C@@H]1C=C[C@@H](O)CCCCC |
| InChI | InChI=1S/C20H33F3O2S/c1-3-5-7-9-13-26-19-16(12-11-15(24)10-8-6-4-2)18(25)14-17(19)20(21,22)23/h11-12,15-16,18,24-25H,3-10,13-14H2,1-2H3/t15-,16-,18+/m0/s1 |
| InChIKey | FQLSXPYIJORLCH-XYJFISCASA-N |
| XLogP | 5.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|