C13H20OS — CID 22298064
1-(5-ethenylcyclopent-2-en-1-yl)-2-ethylsulfanylbut-3-en-1-ol (PubChem CID 22298064) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(5-ethenylcyclopent-2-en-1-yl)-2-ethylsulfanylbut-3-en-1-ol.
| Compound Name | 1-(5-ethenylcyclopent-2-en-1-yl)-2-ethylsulfanylbut-3-en-1-ol |
|---|---|
| PubChem CID | 22298064 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(5-ethenylcyclopent-2-en-1-yl)-2-ethylsulfanylbut-3-en-1-ol |
| SMILES | C=CC1CC=CC1C(O)C(C=C)SCC |
| InChI | InChI=1S/C13H20OS/c1-4-10-8-7-9-11(10)13(14)12(5-2)15-6-3/h4-5,7,9-14H,1-2,6,8H2,3H3 |
| InChIKey | FRBIILKWKOHSBO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|