C26H49OS+ — CID 59999978
(1-cyclohexa-2,4-dien-1-yl-1-hydroxy-2-methylpropan-2-yl)-dioctylsulfanium (PubChem CID 59999978) has the molecular formula C26H49OS+ and a molecular weight of 409.74 g/mol. Its IUPAC name is (1-cyclohexa-2,4-dien-1-yl-1-hydroxy-2-methylpropan-2-yl)-dioctylsulfanium.
| Compound Name | (1-cyclohexa-2,4-dien-1-yl-1-hydroxy-2-methylpropan-2-yl)-dioctylsulfanium |
|---|---|
| PubChem CID | 59999978 |
| Molecular Formula | C26H49OS+ |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | (1-cyclohexa-2,4-dien-1-yl-1-hydroxy-2-methylpropan-2-yl)-dioctylsulfanium |
| SMILES | CCCCCCCC[S+](CCCCCCCC)C(C)(C)C(O)C1C=CC=CC1 |
| InChI | InChI=1S/C26H49OS/c1-5-7-9-11-13-18-22-28(23-19-14-12-10-8-6-2)26(3,4)25(27)24-20-16-15-17-21-24/h15-17,20,24-25,27H,5-14,18-19,21-23H2,1-4H3/q+1 |
| InChIKey | LVLJTOAFWVLRJG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|