C11H16OS — CID 141210750
3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol (PubChem CID 141210750) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is 3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol.
| Compound Name | 3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol |
|---|---|
| PubChem CID | 141210750 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol |
| SMILES | CC1(C)CSC2=CC=CCC2C1O |
| InChI | InChI=1S/C11H16OS/c1-11(2)7-13-9-6-4-3-5-8(9)10(11)12/h3-4,6,8,10,12H,5,7H2,1-2H3 |
| InChIKey | ZEOJLLWEVLXIPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |